Cas:128322-44-1 ,
MCLA,2-Methyl-6-(4-methoxyphenyl)-3,7-dihydroimidazo(1,2-a)pyrazin-3-one hydrochloride
C14H13ClN3O2 / 290.72
MFCD00144728
2-Methyl-6-(4-methoxyphenyl)-3,7-dihydroimidazo(1,2-a)pyrazin-3-one hydrochloride (ABI) is a potent and selective inhibitor of the enzyme toll-like receptor. The drug has been shown to decrease the metabolic rate in experimental models. ABI has also been used as an analog for other compounds to study their effects on redox potentials and reactive species. It is unclear how ABI inhibits protein synthesis by polymerase chain reaction (PCR). One possible mechanism is that it may inhibit the binding of primers to DNA. ABI also inhibits the production of chemokines which are small proteins that stimulate inflammatory responses. This drug can be used in autoimmune diseases such as rheumatoid arthritis and multiple sclerosis.
| CAS Number | 128322-44-1 |
| Product Name | 6-(4-Methoxyphenyl)-2-methylimidazo[1,2-a]pyrazin-3(7H)-one hydrochloride |
| IUPAC Name | 6-(4-methoxyphenyl)-2-methylimidazo[1,2-a]pyrazin-3-ol;hydrochloride |
| Molecular Formula | C14H14ClN3O2 |
| Molecular Weight | 291.73 g/mol |
| InChI | InChI=1S/C14H13N3O2.ClH/c1-9-14(18)17-8-12(15-7-13(17)16-9)10-3-5-11(19-2)6-4-10;/h3-8,18H,1-2H3;1H |
| InChI Key | KGMPQNFFCUDXSO-UHFFFAOYSA-N |
| SMILES | CC1=C(N2C=C(N=CC2=N1)C3=CC=C(C=C3)OC)O.Cl |
| Synonyms | 6-(4-methoxyphenyl)-2-methyl-imidazo[1,2-a]pyrazin-3(7H)-one, monohydrochloride |
| Canonical SMILES | CC1=NC2=CNC(=CN2C1=O)C3=CC=C(C=C3)OC.Cl |
| Isomeric SMILES | CC1=NC2=CNC(=CN2C1=O)C3=CC=C(C=C3)OC.Cl |
Contact: Mr.Li
Phone: 13621067991(wechat)
Tel: 13552979007(wechat)
Email: chemsynlab@163.com, zhangchao@chemsynlab.com
Add: A411 Room,No.26,Jinyuan Road,Daxing Industrial Developing District,Beijing,China post code:102628