5894-59-7 , Digalacturonic acid
C12H18O13 / 370.26
4-O-alpha-D-Galactopyranuronosyl-D-galacturonic acid, also known as digalacturonic acid or sodium digalacturonate, belongs to the class of organic compounds known as o-glucuronides. These are glucuronides in which the aglycone is linked to the carbohydrate unit through an O-glycosidic bond. 4-O-alpha-D-Galactopyranuronosyl-D-galacturonic acid is soluble (in water) and a moderately acidic compound (based on its pKa).
| CAS Number | 5894-59-7 |
| Product Name | Digalacturonate |
| IUPAC Name | 6-(2-carboxy-4,5,6-trihydroxyoxan-3-yl)oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
| Molecular Formula | C12H18O13 |
| Molecular Weight | 370.26 g/mol |
| InChI | InChI=1S/C12H18O13/c13-1-2(14)7(9(18)19)25-12(5(1)17)24-6-3(15)4(16)11(22)23-8(6)10(20)21/h1-8,11-17,22H,(H,18,19)(H,20,21) |
| InChI Key | IGSYEZFZPOZFNC-LKIWRGPLSA-N |
| SMILES | C1(C(C(OC(C1O)OC2C(C(C(OC2C(=O)O)O)O)O)C(=O)O)O)O |
| Synonyms | digalacturonate, digalacturonic acid, digalacturonic acid, (D,alpha-D)-isomer, O-(alpha-D-galactopyranosyluronic acid)-(1-4)-alpha-D-galactopyranuronic acid, sodium digalacturonate |
| Canonical SMILES | C1(C(C(OC(C1O)OC2C(C(C(OC2C(=O)O)O)O)O)C(=O)O)O)O |
| Isomeric SMILES | [C@@H]1([C@H]([C@H](O[C@@H]([C@@H]1O)O[C@@H]2[C@@H]([C@H](C(O[C@@H]2C(=O)O)O)O)O)C(=O)O)O)O |
Contact: Mr.Li
Phone: 13621067991(wechat)
Tel: 13552979007(wechat)
Email: chemsynlab@163.com, zhangchao@chemsynlab.com
Add: A411 Room,No.26,Jinyuan Road,Daxing Industrial Developing District,Beijing,China post code:102628