114305-99-6 , 6-Chloro-3-indoxyl-3-acetate
C10H8ClNO2 / 209.63
MFCD00269776
6-Chloro-3-indoxyl-3-acetate is a fluorogenic substrate used in food testing and environmental testing. It is also a chromogenic substrate that can be conjugated to an enzyme or ligand for use in diagnostics. 6-Chloro-3-indoxyl-3-acetate has high purity and quality, and is CAS No. 114305-99-6. It reacts with hydrogen peroxide to form 6-(chloromethyl) indole, which generates light when oxidized by the horseradish peroxidase enzyme. This reaction is called chemiluminescence or bioluminescence, depending on the type of reaction being catalyzed by the horseradish peroxidase enzyme.
| CAS Number | 114305-99-6 |
| Product Name | 6-chloro-1H-indol-3-yl acetate |
| IUPAC Name | (6-chloro-1H-indol-3-yl) acetate |
| Molecular Formula | C10H8ClNO2 |
| Molecular Weight | 209.63 g/mol |
| InChI | InChI=1S/C10H8ClNO2/c1-6(13)14-10-5-12-9-4-7(11)2-3-8(9)10/h2-5,12H,1H3 |
| InChI Key | IPTGFPYPSDDUBV-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CNC2=C1C=CC(=C2)Cl |
| Canonical SMILES | CC(=O)OC1=CNC2=C1C=CC(=C2)Cl |
Contact: Mr.Li
Phone: 13621067991(wechat)
Tel: 13552979007(wechat)
Email: chemsynlab@163.com, zhangchao@chemsynlab.com
Add: A411 Room,No.26,Jinyuan Road,Daxing Industrial Developing District,Beijing,China post code:102628