383417-46-7 , Fuc-a-1-2-Gal-a-PNP;
4-Nitrophenyl 2-O-(a-L-fucopyranosyl)-a-D-galactopyranoside
Cas:383417-46-7
C18H25NO12 / 447.39
MFCD01863437
Fuc-a-1-2-Gal-a-PNP
4-Nitrophenyl 2-O-(a-L-fucopyranosyl)-a-D-galactopyranoside is a chromogenic pNP enzyme substrate consisting of a fucose and galactose moieties. Upon enzymatic hydrolysis by specific fucosidases or galactosidases, it releases the highly chromogenic molecule 4-nitrophenol, which exhibits a distinct yellow color that can be monitored spectrophotometrically. This substrate is frequently used to study enzyme specificity, kinetics, and inhibition, and it plays a critical role in the investigation of carbohydrate active enzymes (CAZymes), the screening of enzyme inhibitors, and the development of novel analytical methods for the detection and quantitation of enzyme activities.
| CAS Number | 383417-46-7 |
| Product Name | 4-Nitrophenyl 2-O-(a-L-fucopyranosyl)-a-D-galactopyranoside |
| IUPAC Name | (2S,3S,4R,5S,6S)-2-[(2R,3R,4S,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-(4-nitrophenoxy)oxan-3-yl]oxy-6-methyloxane-3,4,5-triol |
| Molecular Formula | C??H??NO?? |
| Molecular Weight | 447.39 |
| InChI | InChI=1S/C18H25NO12/c1-7-11(21)13(23)15(25)17(28-7)31-16-14(24)12(22)10(6-20)30-18(16)29-9-4-2-8(3-5-9)19(26)27/h2-5,7,10-18,20-25H,6H2,1H3/t7-,10+,11+,12-,13+,14-,15-,16+,17-,18-/m0/s1 |
| SMILES | CC1C(C(C(C(O1)OC2C(C(C(OC2OC3=CC=C(C=C3)[N+](=O)[O-])CO)O)O)O)O)O |
| Synonyms | 4-Nitrophenyl 2-O-(6-Deoxy-α-L-galactopyranosyl)-α-D-galactopyranoside; |
Contact: Mr.Li
Phone: 13621067991(wechat)
Tel: 13552979007(wechat)
Email: chemsynlab@163.com, zhangchao@chemsynlab.com
Add: A411 Room,No.26,Jinyuan Road,Daxing Industrial Developing District,Beijing,China post code:102628