51349-63-4 , Naphthol AS-BI b-D-galactopyranoside;
7-Bromo-3-(b-D-galactopyranosyloxy)-N-(2-methoxyphenyl)-2-naphthalenecarboxamide,
Cas:51349-63-4
C24H24BrNO8 / 534.35
MFCD00076133
Naphthol AS-BI b-D-galactopyranoside
Naphthol AS-BI b-D-galactopyranoside is a naphthol derivate that hydrolyzes to form indolyl. It has been shown to inhibit β-galactosidase activity in mice by competitive inhibition, and it has also been shown to be a coupling agent for the synthesis of beta-naphthol derivatives. Naphthol AS-BI b-D-galactopyranoside can be used in freeze dried organs as a coupling agent for the synthesis of indolyl derivatives.
Naphthol AS-BI beta-D-galactopyranoside is a synthetic compound that has gained significant attention from researchers in various fields of study. This compound is widely used in scientific experiments due to its unique physical and chemical properties.
| CAS Number | 51349-63-4 |
| Product Name | Naphthol AS-BI beta-D-galactopyranoside |
| IUPAC Name | 7-bromo-N-(2-methoxyphenyl)-3-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxynaphthalene-2-carboxamide |
| Molecular Formula | C24H24BrNO8 |
| Molecular Weight | 534.35 g/mol |
| InChI | InChI=1S/C24H24BrNO8/c1-32-17-5-3-2-4-16(17)26-23(31)15-9-13-8-14(25)7-6-12(13)10-18(15)33-24-22(30)21(29)20(28)19(11-27)34-24/h2-10,19-22,24,27-30H,11H2,1H3,(H,26,31)/t19-,20+,21+,22-,24-/m1/s1 |
| InChI Key | SISGBWZDEMMSLV-KQWJERSKSA-N |
| SMILES | COC1=CC=CC=C1NC(=O)C2=C(C=C3C=CC(=CC3=C2)Br)OC4C(C(C(C(O4)CO)O)O)O |
| Synonyms | naphthol AS-BI beta-galactopyranoside |
| Canonical SMILES | COC1=CC=CC=C1NC(=O)C2=C(C=C3C=CC(=CC3=C2)Br)OC4C(C(C(C(O4)CO)O)O)O |
| Isomeric SMILES | COC1=CC=CC=C1NC(=O)C2=C(C=C3C=CC(=CC3=C2)Br)O[C@H]4[C@@H]([C@H]([C@H]([C@H](O4)CO)O)O)O |
Contact: Mr.Li
Phone: 13621067991(wechat)
Tel: 13552979007(wechat)
Email: chemsynlab@163.com, zhangchao@chemsynlab.com
Add: A411 Room,No.26,Jinyuan Road,Daxing Industrial Developing District,Beijing,China post code:102628