551-84-8,D-Xylulose,
CAS:551-84-8
C5H10O5 / 150.13
MFCD00065958
D-Xylulose is a ketopentose, a monosaccharide containing five carbon atoms and a ketone functional group. It is converted from xylitol in the glucoronate-xylulose pathway. D-Xylulokinase catalyzes the ATP-dependent phosphorylation of D-xylulose to produce xylulose 5-phosphate, which is linked to the pentose-phosphate pathway.
D-Xylulose, also known as D-lyxulose or D-threo-pentulose, belongs to the class of organic compounds known as pentoses. These are monosaccharides in which the carbohydrate moiety contains five carbon atoms. D-Xylulose exists as a liquid, soluble (in water), and a very weakly acidic compound (based on its pKa). D-Xylulose has been detected in multiple biofluids, such as urine, blood, and cerebrospinal fluid. Within the cell, D-xylulose is primarily located in the cytoplasm. D-Xylulose exists in all eukaryotes, ranging from yeast to humans. D-Xylulose participates in a number of enzymatic reactions. In particular, D-Xylulose can be biosynthesized from D-xylitol through the action of the enzyme D-xylulose reductase. In addition, D-Xylulose can be converted into xylulose 5-phosphate; which is catalyzed by the enzyme xylulose kinase. D-Xylulose has been linked to several inborn metabolic disorders including pentosuria and ribose-5-phosphate isomerase deficiency.
D-xylulose is the D-enantiomer of xylulose. It has a role as a human metabolite, an Escherichia coli metabolite, a Saccharomyces cerevisiae metabolite and a mouse metabolite. It is an enantiomer of a L-xylulose.
A 5-carbon keto sugar.
| CAS Number | 551-84-8 |
| Product Name | D-xylulose |
| IUPAC Name | (3S,4R)-1,3,4,5-tetrahydroxypentan-2-one |
| Molecular Formula | C5H10O5 |
| Molecular Weight | 150.13 g/mol |
| InChI | InChI=1S/C5H10O5/c6-1-3(8)5(10)4(9)2-7/h3,5-8,10H,1-2H2/t3-,5+/m1/s1 |
| InChI Key | ZAQJHHRNXZUBTE-WUJLRWPWSA-N |
| SMILES | C(C(C(C(=O)CO)O)O)O |
| Synonyms | Lyxulose, Xylulose, Xylulose, (D-threo)-Isomer, Xylulose, (L-threo)-Isomer |
| Canonical SMILES | C(C(C(C(=O)CO)O)O)O |
| Isomeric SMILES | C([C@H]([C@@H](C(=O)CO)O)O)O |
| CAS No: 551-84-8 MDL No: MFCD00065958 Chemical Formula: C5H10O5 Molecular Weight: 150.13 |
We can also supply similar following products.
| D-Psicose or D-Allulose | CAS: | 551-68-8,23140-52-5 |
| D-Fructose | CAS: | 57-48-7 |
| a-D-Fructopyranose | CAS: | 10489-81-3 |
| b-D-Fructopyranose | CAS: | 7660-25-5 |
| a-D-Fructofuranose | CAS: | 10489-79-9 |
| b-D-Fructofuranose | CAS: | 470-23-5 |
| L-Fructose | CAS: | 7776-48-9 |
| L-Sorbose | CAS: | 87-79-6 |
| D-Sorbose | CAS: | 3615-56-3 |
| D-Xylulose | CAS: | 551-84-8 |
| L-Xylulose | CAS: | 527-50-4 |
| 3-Deoxy-D-glucosone | CAS: | 4084-27-9 |
| D-Erythrulose | CAS: | 496-55-9 |
| D-Threose | CAS: | 533-50-6 |
| 1-Deoxy-D-ribulose | CAS: | |
| 1-Deoxy-D-xylulose | CAS: | 60299-43-6 |
Contact: Mr.Li
Phone: 13621067991(wechat)
Tel: 13552979007(wechat)
Email: chemsynlab@163.com, zhangchao@chemsynlab.com
Add: A411 Room,No.26,Jinyuan Road,Daxing Industrial Developing District,Beijing,China post code:102628